Hidrat Hóa 2 Anken Chỉ Tạo Thành 2 Ancol


Bạn đang xem: Hidrat hóa 2 anken chỉ tạo thành 2 ancol

*
*
*
*
*
*
*
*

Cho những chất sau: 2-metylbut-1-en (1); 3,3-đimetylbut-1-en (2); 3-metylpent-1-en (3); 3-metylpent-2-en (4). Những chất làm sao là đồng phân của nhau ?


Cho các chất sau: CH2=CHCH2CH2CH=CH2; CH2=CHCH=CHCH2CH3; CH3C(CH3)=CHCH2; CH2=CHCH2CH=CH2; CH3CH2CH=CHCH2CH3; CH3C(CH3)=CHCH2CH3; CH3CH2C(CH3)=C(C2H5)CH(CH3)2; CH3CH=CHCH3.

Số chất bao gồm đồng phân hình học là:


Anken C4H8 gồm bao nhiêu đồng phân Khi tính năng cùng với hỗn hợp HCl chỉ cho 1 sản phẩm hữu cơ độc nhất vô nhị ?


Ba hiđrocacbon X, Y, Z tiếp đến nhau trong dãy đồng đẳng, trong số đó trọng lượng phân tử Z gấp đôi cân nặng phân tử X. Đốt cháy 0,1 mol chất Y, sản phẩm khí dung nạp hoàn toàn vào dung dịch Ca(OH)2 dư, nhận được số gam kết tủa là:


Cho hiđrocacbon X phản ứng với brom (vào dung dịch) theo tỉ trọng mol 1 : 1, nhận được hóa học cơ học Y (đựng 74,08% Br về kăn năn lượng). khi X làm phản ứng với HBr thì chiếm được nhị sản phẩm cơ học khác nhau. Tên gọi của X là:


Để khử trọn vẹn 200 ml dung dịch KMnO4 0,2M chế tác thành hóa học rắn màu nâu Black cần V lít khí C2H4 (ngơi nghỉ đktc). Giá trị tối tphát âm của V là:


Hỗn hòa hợp khí X gồm H2 cùng C2H4 gồm tỉ khối so với He là 3,75. Dẫn X qua Ni nung rét, chiếm được các thành phần hỗn hợp khí Y bao gồm tỉ kân hận đối với He là 5. Hiệu suất của bội nghịch ứng hiđro hoá là:


Cho buta-1,3-đien làm phản ứng cùng cùng với Br2 theo tỉ lệ mol 1:1. Số dẫn xuất đibrom (đồng phân kết cấu với đồng phân hình học) chiếm được là:


Cho 3,12 gam ankin X bội nghịch ứng cùng với 0,1 mol H2 (xúc tác Pd/PbCO3, to), thu được hỗn hợp Y chỉ đựng hai hiđrocacbon. Công thức phân tử của X là:


Xem thêm:

Cho 3,36 lít khí hiđrocacbon X (đktc) phản bội ứng trọn vẹn cùng với lượng dư dung dịch AgNO3 vào NH3, nhận được 36 gam kết tủa. Công thức phân tử của X là:


Đốt cháy hoàn toàn 6,72 lkhông nhiều (đktc) các thành phần hỗn hợp tất cả hai hiđrocacbon X với Y (MY > MX), chiếm được 1nửa lít khí CO2 (đktc) cùng 10,8 gam H2O. Công thức của X là:


Đốt cháy hoàn toàn các thành phần hỗn hợp M gồm một ankan X cùng một ankin Y, thu được số mol CO2 ngay số mol H2O. Thành phần xác suất về số mol của X với Y trong hỗn hợp M thứu tự là:


Đốt cháy hoàn toàn 0,2 mol các thành phần hỗn hợp X tất cả một ankan với một anken, chiếm được 0,35 mol CO2 và 0,4 mol H2O. Phần trăm số mol của anken vào X là:


Đốt cháy hoàn toàn 1 lkhông nhiều hỗn hợp khí tất cả C2H2 cùng hiđrocacbon X ra đời 2 lkhông nhiều khí CO2 cùng 2 lít hơi H2O (những thể tích khí cùng khá đo ở thuộc điều kiện nhiệt độ, áp suất). Công thức phân tử của X là:


Dẫn 1,68 lít các thành phần hỗn hợp khí X có nhị hiđrocacbon vào bình đựng dung dịch brom (dư). Sau Khi bội nghịch ứng xảy ra trọn vẹn, tất cả 4 gam brom sẽ bội nghịch ứng với còn sót lại 1,12 lít khí. Nếu đốt cháy trọn vẹn 1,68 lkhông nhiều X thì ra đời 2,8 lkhông nhiều khí CO2. Biết những thể tích khí đầy đủ đo sống đktc. Công thức phân tử của hai hiđrocacbon là:


Hỗn hợp X bao gồm tỉ khối đối với H2 là 21,2 bao gồm propan, propen với propin. Lúc đốt cháy trọn vẹn 0,1 mol X, tổng khối lượng của CO2 và H2O nhận được là:


Cho các thành phần hỗn hợp X tất cả CH4, C2H4 với C2H2. Lấy 8,6 gam X tác dụng hết với dung dịch brom (dư) thì cân nặng brom bội phản ứng là 48 gam. Mặt khác, trường hợp mang lại 13,44 lkhông nhiều (ở đktc) hỗn hợp khí X công dụng với lượng dư hỗn hợp AgNO3 vào NH3, thu được 36 gam kết tủa. Phần trăm thể tích của CH4 tất cả trong X là:


Hỗn vừa lòng khí X bao gồm 0,3 mol H2 cùng 0,1 mol vinylaxetilen. Nung X một thời hạn cùng với xúc tác Ni nhận được các thành phần hỗn hợp khí Y có tỉ kăn năn so với bầu không khí là một. Nếu cho toàn bộ Y sục thủng thẳng vào hỗn hợp brom (dư) thì có m gam brom tđắm say gia bội nghịch ứng. Giá trị của m là:


Dẫn V lít (làm việc đktc) hỗn hợp X có axetilen cùng hiđro đi qua ống sứ nung lạnh, nhận được khí Y. Dẫn Y vào lượng dư AgNO3 (hoặc Ag2O) trong hỗn hợp NH3 nhận được 12 gam kết tủa. Khí đi thoát ra khỏi dung dịch bội nghịch ứng trọn vẹn cùng với 16 gam brom và sót lại khí Z. Đốt cháy trọn vẹn khí Z thu được 2,24 lkhông nhiều khí CO2 (ở đktc) với 4,5 gam nước. Giá trị của V bằng:


Đun lạnh tất cả hổn hợp X tất cả 0,06 mol C2H2 với 0,04 mol H2 với xúc tác Ni, sau đó 1 thời hạn thu được tất cả hổn hợp khí Y. Dẫn toàn cục các thành phần hỗn hợp Y lội thanh nhàn qua bình đựng hỗn hợp brom (dư) thì còn lại 0,448 lkhông nhiều các thành phần hỗn hợp khí Z (làm việc đktc) tất cả tỉ khối đối với O2 là 0,5. Khối lượng bình dung dịch brom tăng là:


Đốt cháy hoàn toàn 0,16 mol hỗn hợp X tất cả CH4, C2H2, C2H4 với C3H6, chiếm được 6,272 lít CO2(đktc) cùng 6,12 gam H2O. Mặt không giống 10,1 gam X làm phản ứng buổi tối nhiều với a mol Br2 vào dung dịch. Giá trị của a là